* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 9-(2-NITROVINYL)ANTHRACENE |
CAS: | 58349-77-2 |
English Synonyms: | 9-(2-NITROVINYL)ANTHRACENE |
MDL Number.: | MFCD00003577 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)cc3ccccc3c2/C=C/[N+](=O)[O-] |
InChi: | InChI=1S/C16H11NO2/c18-17(19)10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16/h1-11H/b10-9+ |
InChiKey: | InChIKey=GYOMWYPUMGJROJ-MDZDMXLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.