* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LABOTEST-BB LT00244800 |
English Synonyms: | LABOTEST-BB LT00244800 |
MDL Number.: | MFCD00005082 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1C2C3C(C1C4C2O4)C5(C(=C(C3(C5(Cl)Cl)Cl)Cl)Cl)Cl |
InChi: | InChI=1S/C12H8Cl6O/c13-8-9(14)11(16)5-3-1-2(6-7(3)19-6)4(5)10(8,15)12(11,17)18/h2-7H,1H2 |
InChiKey: | InChIKey=DFBKLUNHFCTMDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.