* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-METHYLINDOLE |
CAS: | 3420-02-8 ;4315-07-5 |
English Synonyms: | 6-METHYLINDOLE ; 6-METHYL-1H-INDOLE ; 1H-INDOLE, 6-METHYL- |
MDL Number.: | MFCD00005682 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | Cc1ccc2cc[nH]c2c1 |
InChi: | InChI=1S/C9H9N/c1-7-2-3-8-4-5-10-9(8)6-7/h2-6,10H,1H3 |
InChiKey: | InChIKey=ONYNOPPOVKYGRS-UHFFFAOYSA-N |
Property |
|
Boiling Point: | MP: 29-32 DEG C/112 °C |
Density: | DENSITY: 1.059 G/ML AT 25 DEG C(LIT) |
Physical Property: | FLASHPOINT: 110 DEG C FLASHPOINT: 230 DEG F REFRACTIVE INDEX: N20/D 1.607(LIT) |
Comments: | UNSPSC: 12352100 WGK: 3 |
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H315-H319-H335 |
Precautionary statements: | P261-P305 + P351 + P338 |
hazard symbol: | Xi |
Risk Code: | R:36/37/38 |
Safe Code: | S:26-36 |
UN Code: | 3334 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.