* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HETERONEMIN |
| CAS: | 62008-04-2 |
| English Synonyms: | HETERONEMIN |
| MDL Number.: | MFCD00010047 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(=O)OC1C[C@H]2[C@@]3(CCC4C(CCC[C@@]4([C@H]3C[C@H](C2(C5C1=COC5OC(=O)C)C)O)C)(C)C)C |
| InChi: | InChI=1S/C29H44O6/c1-16(30)34-19-13-22-28(6)12-9-20-26(3,4)10-8-11-27(20,5)21(28)14-23(32)29(22,7)24-18(19)15-33-25(24)35-17(2)31/h15,19-25,32H,8-14H2,1-7H3/t19?,20?,21-,22+,23-,24?,25?,27+,28-,29?/m1/s1 |
| InChiKey: | InChIKey=VYIQDOVNWPEWRJ-WQNSBBFRSA-N |
|
|
| Comments: | WGK: 3 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.