* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LABOTEST-BB LT00453994 |
English Synonyms: | LABOTEST-BB LT00453994 |
MDL Number.: | MFCD00010498 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)/C=N/c2cc(cc3c2c(cc(c3)S(=O)(=O)O)O)S(=O)(=O)[O-])O.[Na+] |
InChi: | InChI=1S/C17H13NO8S2.Na/c19-15-4-2-1-3-10(15)9-18-14-7-12(27(21,22)23)5-11-6-13(28(24,25)26)8-16(20)17(11)14;/h1-9,19-20H,(H,21,22,23)(H,24,25,26);/q;+1/p-1/b18-9+; |
InChiKey: | InChIKey=VDMRMECRCLGIAD-WUBZALIBSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.