* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GRANULAR BLUE |
| CAS: | 71431-29-3 |
| English Synonyms: | GRANULAR BLUE |
| MDL Number.: | MFCD00012680 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | c1cc(ccc1c2cc3ccc(cc3[nH]2)C(=O)N)OCCOc4ccc(cc4)C(=N)N.Cl.Cl |
| InChi: | InChI=1S/C24H22N4O3.2ClH/c25-23(26)16-5-9-20(10-6-16)31-12-11-30-19-7-3-15(4-8-19)21-13-17-1-2-18(24(27)29)14-22(17)28-21;;/h1-10,13-14,28H,11-12H2,(H3,25,26)(H2,27,29);2*1H |
| InChiKey: | InChIKey=LSFMDPMWJFFWOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.