* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YTTERBIUM ACETATE |
| English Synonyms: | YTTERBIUM ACETATE |
| MDL Number.: | MFCD00013047 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC(=O)O[Yb](OC(=O)C)OC(=O)C |
| InChi: | InChI=1S/3C2H4O2.Yb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3 |
| InChiKey: | InChIKey=OSCVBYCJUSOYPN-UHFFFAOYSA-K |
* If the product has intellectual property rights, a license granted is must or contact us.