* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLOROOCTANE |
| CAS: | 999-07-5 |
| English Synonyms: | 5-CHLOROOCTANE ; 4-CHLOROOCTANE |
| MDL Number.: | MFCD00013677 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCCC(CCC)Cl |
| InChi: | InChI=1S/C8H17Cl/c1-3-5-7-8(9)6-4-2/h8H,3-7H2,1-2H3 |
| InChiKey: | InChIKey=SRGMFDQMGOZQPO-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.