* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-FLUORENYL ACETATE |
CAS: | 25017-68-9 |
English Synonyms: | 9-FLUORENYL ACETATE |
MDL Number.: | MFCD00016354 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=O)OC1c2ccccc2-c3c1cccc3 |
InChi: | InChI=1S/C15H12O2/c1-10(16)17-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-9,15H,1H3 |
InChiKey: | InChIKey=UWSLPNWPRYFAMX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.