* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LEUCOCYANIDIN |
| English Synonyms: | LEUCOCYANIDIN |
| MDL Number.: | MFCD00016962 |
| H bond acceptor: | 7 |
| H bond donor: | 6 |
| Smile: | c1cc(c(cc1C2C(C(c3c(cc(cc3O2)O)O)O)O)O)O |
| InChi: | InChI=1S/C15H14O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,13-21H |
| InChiKey: | InChIKey=SBZWTSHAFILOTE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.