Molecular Structure:
CCD No.:CCD00016149
OTAVA-BB 3360152
Formula:C15 H12 O5
MolWeight:272.255
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3360152 |
| English Synonyms： | OTAVA-BB 3360152 |
| MDL Number.： | MFCD00017739 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | c1cc(c(cc1C2CC(=O)c3ccc(cc3O2)O)O)O |
| InChi： | InChI=1S/C15H12O5/c16-9-2-3-10-12(18)7-14(20-15(10)6-9)8-1-4-11(17)13(19)5-8/h1-6,14,16-17,19H,7H2 |
| InChiKey： | InChIKey=MJBPUQUGJNAPAZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
