* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BROMO-2-NITROFLUORENE |
CAS: | 53172-79-5 |
English Synonyms: | 9-BROMO-2-NITROFLUORENE |
MDL Number.: | MFCD00019067 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)-c3ccc(cc3C2Br)[N+](=O)[O-] |
InChi: | InChI=1S/C13H8BrNO2/c14-13-11-4-2-1-3-9(11)10-6-5-8(15(16)17)7-12(10)13/h1-7,13H |
InChiKey: | InChIKey=MQMLOKJKGOPCKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.