* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RUBICENE |
CAS: | 197-61-5 |
English Synonyms: | RUBICENE |
MDL Number.: | MFCD00021273 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)c3cccc4c3c2c5cccc6c5c4c7c6cccc7 |
InChi: | InChI=1S/C26H14/c1-3-9-17-15(7-1)19-11-5-13-22-24-18-10-4-2-8-16(18)20-12-6-14-21(26(20)24)23(17)25(19)22/h1-14H |
InChiKey: | InChIKey=FMKFBRKHHLWKDB-UHFFFAOYSA-N |
Property |
|
Melting Point: | 305 DEG C |
Comments: | EINECS: 205-899-5 HAZARD: S24/25 TSCA: N |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.