* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-1,2,3,4-DIBENZOPHENAZINE |
CAS: | 4559-60-8 |
English Synonyms: | 7-METHYL-1,2,3,4-DIBENZOPHENAZINE |
MDL Number.: | MFCD00022301 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1ccc2c(c1)nc3c4ccccc4c5ccccc5c3n2 |
InChi: | InChI=1S/C21H14N2/c1-13-10-11-18-19(12-13)23-21-17-9-5-3-7-15(17)14-6-2-4-8-16(14)20(21)22-18/h2-12H,1H3 |
InChiKey: | InChIKey=CCVWHOGATVQYQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.