* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-SULFOLANYL ETHER |
CAS: | 29422-01-3 |
English Synonyms: | 3-SULFOLANYL ETHER |
MDL Number.: | MFCD00022541 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | C1CS(=O)(=O)CC1OC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C8H14O5S2/c9-14(10)3-1-7(5-14)13-8-2-4-15(11,12)6-8/h7-8H,1-6H2 |
InChiKey: | InChIKey=LXMDAGYXJGGKTH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.