* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3-DICHLORO-P-DIOXANE |
| CAS: | 95-59-0 |
| English Synonyms: | 2,3-DICHLORO-1,4-DIOXANE ; 2,3-DICHLORO-P-DIOXANE |
| MDL Number.: | MFCD00023827 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1COC(C(O1)Cl)Cl |
| InChi: | InChI=1S/C4H6Cl2O2/c5-3-4(6)8-2-1-7-3/h3-4H,1-2H2 |
| InChiKey: | InChIKey=ZOZUXFQYIYUIND-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.