* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(2-ETHYLCROTONOYL)UREA |
CAS: | 5982-97-8 |
English Synonyms: | 1-(2-ETHYLCROTONOYL)UREA |
MDL Number.: | MFCD00025443 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC/C(=C\C)/C(=O)NC(=O)N |
InChi: | InChI=1S/C7H12N2O2/c1-3-5(4-2)6(10)9-7(8)11/h3H,4H2,1-2H3,(H3,8,9,10,11)/b5-3+ |
InChiKey: | InChIKey=QCUPYFTWJOZAOB-HWKANZROSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.