* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-PHE-MET-OME |
CAS: | 78816-88-3 |
English Synonyms: | Z-PHE-MET-OME |
MDL Number.: | MFCD00026042 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COC(=O)[C@H](CCSC)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C23H28N2O5S/c1-29-22(27)19(13-14-31-2)24-21(26)20(15-17-9-5-3-6-10-17)25-23(28)30-16-18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3,(H,24,26)(H,25,28)/t19-,20-/m0/s1 |
InChiKey: | InChIKey=XYCPRHWDUCLQFN-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.