* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-VAL-OH |
| CAS: | 14550-79-9 |
| English Synonyms: | Z-ALA-VAL-OH ; Z-L-ALANYL-L-VALINE |
| MDL Number.: | MFCD00026455 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C16H22N2O5/c1-10(2)13(15(20)21)18-14(19)11(3)17-16(22)23-9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3,(H,17,22)(H,18,19)(H,20,21)/t11-,13-/m0/s1 |
| InChiKey: | InChIKey=MSDUZLXFEMEMNF-AAEUAGOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.