* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-ALA-LEU-NH2 |
English Synonyms: | CBZ-L-ALA-L-LEU NH2 ; Z-ALA-LEU-NH2 |
MDL Number.: | MFCD00026502 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(C)C[C@@H](C(=O)N)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C17H25N3O4/c1-11(2)9-14(15(18)21)20-16(22)12(3)19-17(23)24-10-13-7-5-4-6-8-13/h4-8,11-12,14H,9-10H2,1-3H3,(H2,18,21)(H,19,23)(H,20,22)/t12-,14-/m0/s1 |
InChiKey: | InChIKey=RVVQEXKXIZCDGV-JSGCOSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.