* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-AB001813 |
| English Synonyms: | ZERENEX ZX-AB001813 |
| MDL Number.: | MFCD00029454 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)CNC(=O)[C@@H]2CCCC[C@@H]2C(=O)O |
| InChi: | InChI=1S/C15H19NO3/c17-14(16-10-11-6-2-1-3-7-11)12-8-4-5-9-13(12)15(18)19/h1-3,6-7,12-13H,4-5,8-10H2,(H,16,17)(H,18,19)/t12-,13+/m1/s1 |
| InChiKey: | InChIKey=NCAZRKFIGJVHLN-OLZOCXBDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.