* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,4-DIPHENOXYBUTANE |
CAS: | 3459-88-9 |
English Synonyms: | 1,4-DIPHENOXYBUTANE |
MDL Number.: | MFCD00030040 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)OCCCCOc2ccccc2 |
InChi: | InChI=1S/C16H18O2/c1-3-9-15(10-4-1)17-13-7-8-14-18-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
InChiKey: | InChIKey=PMVVWYMWJBCMMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.