* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 5-OXO-5-PHENYLVALERATE |
| CAS: | 73172-56-2 |
| English Synonyms: | ETHYL 5-OXO-5-PHENYLVALERATE |
| MDL Number.: | MFCD00032371 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CCCC(=O)c1ccccc1 |
| InChi: | InChI=1S/C13H16O3/c1-2-16-13(15)10-6-9-12(14)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3 |
| InChiKey: | InChIKey=XBYIXIAOQPIYHO-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.