* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM FH SC 0027 |
| English Synonyms: | RARECHEM FH SC 0027 |
| MDL Number.: | MFCD00032460 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1ccc(c(c1)Nc2ccccc2Br)Br |
| InChi: | InChI=1S/C12H9Br2N/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1-8,15H |
| InChiKey: | InChIKey=BJPIBICIVXDVHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.