* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-FLUOREN-3-AMINE |
CAS: | 6344-66-7 |
English Synonyms: | 3-AMINO-9H-FLUORENE ; 9H-FLUOREN-3-AMINE |
MDL Number.: | MFCD00032833 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc-2c(c1)Cc3c2cc(cc3)N |
InChi: | InChI=1S/C13H11N/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8H,7,14H2 |
InChiKey: | InChIKey=FNGCZPANGGUOPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.