* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-IODO-7-NITROFLUORENE |
| CAS: | 23055-47-2 |
| English Synonyms: | 2-IODO-7-NITRO-9H-FLUORENE ; 2-IODO-7-NITROFLUORENE |
| MDL Number.: | MFCD00032868 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc-2c(cc1[N+](=O)[O-])Cc3c2ccc(c3)I |
| InChi: | InChI=1S/C13H8INO2/c14-10-1-3-12-8(6-10)5-9-7-11(15(16)17)2-4-13(9)12/h1-4,6-7H,5H2 |
| InChiKey: | InChIKey=HSJXILJMBUVJFU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.