* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-NVA-NVA-OH |
English Synonyms: | Z-NVA-NVA-OH |
MDL Number.: | MFCD00034318 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCC[C@@H](C(=O)N[C@@H](CCC)C(=O)O)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C18H26N2O5/c1-3-8-14(16(21)19-15(9-4-2)17(22)23)20-18(24)25-12-13-10-6-5-7-11-13/h5-7,10-11,14-15H,3-4,8-9,12H2,1-2H3,(H,19,21)(H,20,24)(H,22,23)/t14-,15-/m0/s1 |
InChiKey: | InChIKey=RLUYBNYNFLTTOT-GJZGRUSLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.