* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | C 3094 |
CAS: | 77966-27-9 |
English Synonyms: | C 3094 |
MDL Number.: | MFCD00034877 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCN(CC)CC(=O)Nc1ccc(cc1)OCC.Cl |
InChi: | InChI=1S/C14H22N2O2.ClH/c1-4-16(5-2)11-14(17)15-12-7-9-13(10-8-12)18-6-3;/h7-10H,4-6,11H2,1-3H3,(H,15,17);1H |
InChiKey: | InChIKey=QNZMKNCNALLYHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.