* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INS(1,3,4,5)P4 |
English Synonyms: | INS(1,3,4,5)P4 ; MYO-INOSITOL 1,3,4,5-TETRAKISPHOSPHATE |
MDL Number.: | MFCD00036926 |
H bond acceptor: | 18 |
H bond donor: | 10 |
Smile: | [C@@H]1([C@@H]([C@@H]([C@@H]([C@H]([C@@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)O)OP(=O)(O)O)O |
InChi: | InChI=1S/C6H16O18P4/c7-1-3(21-25(9,10)11)2(8)5(23-27(15,16)17)6(24-28(18,19)20)4(1)22-26(12,13)14/h1-8H,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/t1-,2-,3-,4+,5-,6-/m0/s1 |
InChiKey: | InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.