* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-PRO-OH |
| CAS: | 21027-01-0 |
| English Synonyms: | N-CBZ-ALA-PRO ; CBZ-L-ALA-L-PRO ; Z-ALA-PRO-OH ; CBZ-L-ALA-PRO |
| MDL Number.: | MFCD00037335 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C16H20N2O5/c1-11(14(19)18-9-5-8-13(18)15(20)21)17-16(22)23-10-12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3,(H,17,22)(H,20,21)/t11-,13-/m0/s1 |
| InChiKey: | InChIKey=RSSOZTMMMIWOJB-AAEUAGOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.