* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-GLY-PRO-HYP-OH |
CAS: | 2239-67-0 |
English Synonyms: | GLY-PRO-HYDROXY-PRO ; H-GLY-PRO-HYP-OH |
MDL Number.: | MFCD00037343 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | C1C[C@H](N(C1)C(=O)CN)C(=O)N2C[C@@H](C[C@H]2C(=O)O)O |
InChi: | InChI=1S/C12H19N3O5/c13-5-10(17)14-3-1-2-8(14)11(18)15-6-7(16)4-9(15)12(19)20/h7-9,16H,1-6,13H2,(H,19,20)/t7-,8+,9+/m1/s1 |
InChiKey: | InChIKey=SZEOBSAZWJLOGY-VGMNWLOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.