* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-L-TYROSYL-L-THREONINE |
| English Synonyms: | Z-L-TYROSYL-L-THREONINE ; Z-TYR-THR-OH |
| MDL Number.: | MFCD00037809 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)OCc2ccccc2)O |
| InChi: | InChI=1S/C21H24N2O7/c1-13(24)18(20(27)28)23-19(26)17(11-14-7-9-16(25)10-8-14)22-21(29)30-12-15-5-3-2-4-6-15/h2-10,13,17-18,24-25H,11-12H2,1H3,(H,22,29)(H,23,26)(H,27,28)/t13-,17+,18+/m1/s1 |
| InChiKey: | InChIKey=GIYVFJXSCLFRIL-BVGQSLNGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.