* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-HIS-TRP-OH |
CAS: | 23403-90-9 |
English Synonyms: | H-HIS-TRP-OH |
MDL Number.: | MFCD00037949 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)O)NC(=O)[C@H](Cc3c[nH]cn3)N |
InChi: | InChI=1S/C17H19N5O3/c18-13(6-11-8-19-9-21-11)16(23)22-15(17(24)25)5-10-7-20-14-4-2-1-3-12(10)14/h1-4,7-9,13,15,20H,5-6,18H2,(H,19,21)(H,22,23)(H,24,25)/t13-,15-/m0/s1 |
InChiKey: | InChIKey=FBTYOQIYBULKEH-ZFWWWQNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.