* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-LYS-TRP-OH |
CAS: | 50674-18-5 |
English Synonyms: | H-LYS-TRP-OH ; L-LYSYL-L-TRYPTOPHAN |
MDL Number.: | MFCD00037955 |
H bond acceptor: | 7 |
H bond donor: | 5 |
Smile: | c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N |
InChi: | InChI=1S/C17H24N4O3/c18-8-4-3-6-13(19)16(22)21-15(17(23)24)9-11-10-20-14-7-2-1-5-12(11)14/h1-2,5,7,10,13,15,20H,3-4,6,8-9,18-19H2,(H,21,22)(H,23,24)/t13-,15-/m0/s1 |
InChiKey: | InChIKey=RVKIPWVMZANZLI-ZFWWWQNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.