* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ALA-PHE-GLY-OH |
CAS: | 20807-28-7 |
English Synonyms: | H-ALA-PHE-GLY-OH |
MDL Number.: | MFCD00038167 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)O)N |
InChi: | InChI=1S/C14H19N3O4/c1-9(15)13(20)17-11(14(21)16-8-12(18)19)7-10-5-3-2-4-6-10/h2-6,9,11H,7-8,15H2,1H3,(H,16,21)(H,17,20)(H,18,19)/t9-,11-/m0/s1 |
InChiKey: | InChIKey=DHBKYZYFEXXUAK-ONGXEEELSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.