* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-LYS-VAL-OH |
| CAS: | 20556-11-0 |
| English Synonyms: | H-LYS-VAL-OH ; L-LYSYL-L-VALINE |
| MDL Number.: | MFCD00038210 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N |
| InChi: | InChI=1S/C11H23N3O3/c1-7(2)9(11(16)17)14-10(15)8(13)5-3-4-6-12/h7-9H,3-6,12-13H2,1-2H3,(H,14,15)(H,16,17)/t8-,9-/m0/s1 |
| InChiKey: | InChIKey=YQAIUOWPSUOINN-IUCAKERBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.