* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-TYR-LEU-OH |
CAS: | 35971-70-1 |
English Synonyms: | Z-TYR-LEU-OH ; Z-L-TYROSYL-L-LEUCINE |
MDL Number.: | MFCD00038300 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C23H28N2O6/c1-15(2)12-20(22(28)29)24-21(27)19(13-16-8-10-18(26)11-9-16)25-23(30)31-14-17-6-4-3-5-7-17/h3-11,15,19-20,26H,12-14H2,1-2H3,(H,24,27)(H,25,30)(H,28,29)/t19-,20-/m0/s1 |
InChiKey: | InChIKey=SZUJNVXDTHBDRE-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.