* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-LEU-TRP-MET-OH |
English Synonyms: | H-LEU-TRP-MET-OH |
MDL Number.: | MFCD00038606 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)N[C@@H](CCSC)C(=O)O)N |
InChi: | InChI=1S/C22H32N4O4S/c1-13(2)10-16(23)20(27)26-19(21(28)25-18(22(29)30)8-9-31-3)11-14-12-24-17-7-5-4-6-15(14)17/h4-7,12-13,16,18-19,24H,8-11,23H2,1-3H3,(H,25,28)(H,26,27)(H,29,30)/t16-,18-,19-/m0/s1 |
InChiKey: | InChIKey=UIIMIKFNIYPDJF-WDSOQIARSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.