* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-PHE-PRO-ALA-BETANA |
CAS: | 69076-06-8 |
English Synonyms: | H-PHE-PRO-ALA-BNA ; H-PHE-PRO-ALA-BETANA |
MDL Number.: | MFCD00038776 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | C[C@@H](C(=O)Nc1ccc2ccccc2c1)NC(=O)[C@@H]3CCCN3C(=O)[C@H](Cc4ccccc4)N |
InChi: | InChI=1S/C27H30N4O3/c1-18(25(32)30-22-14-13-20-10-5-6-11-21(20)17-22)29-26(33)24-12-7-15-31(24)27(34)23(28)16-19-8-3-2-4-9-19/h2-6,8-11,13-14,17-18,23-24H,7,12,15-16,28H2,1H3,(H,29,33)(H,30,32)/t18-,23-,24-/m0/s1 |
InChiKey: | InChIKey=IIZJVPYPUKBCCG-NWVWQQAFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.