* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-HIS-PHE-TYR-OET |
| English Synonyms: | Z-HIS-PHE-TYR-OET |
| MDL Number.: | MFCD00038811 |
| H bond acceptor: | 12 |
| H bond donor: | 5 |
| Smile: | CCOC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc3c[nH]cn3)NC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C34H37N5O7/c1-2-45-33(43)30(18-24-13-15-27(40)16-14-24)38-31(41)28(17-23-9-5-3-6-10-23)37-32(42)29(19-26-20-35-22-36-26)39-34(44)46-21-25-11-7-4-8-12-25/h3-16,20,22,28-30,40H,2,17-19,21H2,1H3,(H,35,36)(H,37,42)(H,38,41)(H,39,44)/t28-,29-,30-/m0/s1 |
| InChiKey: | InChIKey=QZLUUQBYVBJRRA-DTXPUJKBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.