* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-D-GLU(OTBU)-OSU |
| English Synonyms: | Z-D-GLU(OTBU)-OSU |
| MDL Number.: | MFCD00038821 |
| H bond acceptor: | 12 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)C(C[C@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCc2ccccc2)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C26H34N2O10/c1-25(2,3)36-21(31)17(22(32)37-26(4,5)6)14-18(23(33)38-28-19(29)12-13-20(28)30)27-24(34)35-15-16-10-8-7-9-11-16/h7-11,17-18H,12-15H2,1-6H3,(H,27,34)/t18-/m1/s1 |
| InChiKey: | InChIKey=WOJXZHMOTUVVBG-GOSISDBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.