* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-DIBENZYLANTHRACENE |
CAS: | 3613-42-1 |
English Synonyms: | 9,10-DIBENZYLANTHRACENE |
MDL Number.: | MFCD00039423 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)Cc2c3ccccc3c(c4c2cccc4)Cc5ccccc5 |
InChi: | InChI=1S/C28H22/c1-3-11-21(12-4-1)19-27-23-15-7-9-17-25(23)28(20-22-13-5-2-6-14-22)26-18-10-8-16-24(26)27/h1-18H,19-20H2 |
InChiKey: | InChIKey=FMVRRCDBALUUBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.