* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCINE,SULFATE(2:1) |
CAS: | 23791-92-6 |
English Synonyms: | GLYCINE, SULFATE ; GLYCINE,SULFATE(2:1) |
MDL Number.: | MFCD00042037 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C(C(=O)O)N.C(C(=O)O)N.OS(=O)(=O)O |
InChi: | InChI=1S/2C2H5NO2.H2O4S/c2*3-1-2(4)5;1-5(2,3)4/h2*1,3H2,(H,4,5);(H2,1,2,3,4) |
InChiKey: | InChIKey=QOXQQSIMBSWGOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.