* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7,9-DIHYDRO-7,9-DIMETHYL-1H-PURINE-2,6,8(3H)-TRIONE |
CAS: | 19039-41-9 |
English Synonyms: | 7,9-DIMETHYL-2,3,6,7,8,9-HEXAHYDRO-1H-PURINE-2,6,8-TRIONE ; 7,9-DIHYDRO-7,9-DIMETHYL-1H-PURINE-2,6,8(3H)-TRIONE |
MDL Number.: | MFCD00042779 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cn1c2c([nH]c(=O)[nH]c2=O)n(c1=O)C |
InChi: | InChI=1S/C7H8N4O3/c1-10-3-4(11(2)7(10)14)8-6(13)9-5(3)12/h1-2H3,(H2,8,9,12,13) |
InChiKey: | InChIKey=ZWFQLYWQCGUUNB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.