* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RIBITYL-3,4-XYLIDINE |
English Synonyms: | RIBITYL-3,4-XYLIDINE |
MDL Number.: | MFCD00043348 |
H bond acceptor: | 5 |
H bond donor: | 5 |
Smile: | Cc1ccc(cc1C)NC[C@@H]([C@H]([C@@H](CO)O)O)O |
InChi: | InChI=1S/C13H21NO4/c1-8-3-4-10(5-9(8)2)14-6-11(16)13(18)12(17)7-15/h3-5,11-18H,6-7H2,1-2H3/t11-,12+,13+/m0/s1 |
InChiKey: | InChIKey=ZPFOXBJGVIUHDO-YNEHKIRRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.