* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1376968 |
English Synonyms: | OTAVA-BB 1376968 |
MDL Number.: | MFCD00043624 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)/C=C(/c2ccccc2)\C(=O)N |
InChi: | InChI=1S/C15H13NO/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H2,16,17)/b14-11- |
InChiKey: | InChIKey=VTOAFAPBGXLGME-KAMYIIQDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.