* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC BUTYL PHTHALATE |
| English Synonyms: | ZINC BUTYL PHTHALATE |
| MDL Number.: | MFCD00045831 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CCCCOC(=O)c1ccccc1C(=O)O[Zn]OC(=O)c2ccccc2C(=O)OCCCC |
| InChi: | InChI=1S/2C12H14O4.Zn/c2*1-2-3-8-16-12(15)10-7-5-4-6-9(10)11(13)14;/h2*4-7H,2-3,8H2,1H3,(H,13,14);/q;;+2/p-2 |
| InChiKey: | InChIKey=QDPBLJFTRKLLAO-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.