* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BUTYLANTHRACENE |
CAS: | 1498-69-7 |
English Synonyms: | 9-BUTYLANTHRACENE |
MDL Number.: | MFCD00046207 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCc1c2ccccc2cc3c1cccc3 |
InChi: | InChI=1S/C18H18/c1-2-3-10-18-16-11-6-4-8-14(16)13-15-9-5-7-12-17(15)18/h4-9,11-13H,2-3,10H2,1H3 |
InChiKey: | InChIKey=VNCDUSIZHQJFOG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.