* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VIOLAMINE 3B |
| English Synonyms: | VIOLAMINE 3B |
| MDL Number.: | MFCD00046930 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | CCOc1ccc(cc1)Nc2ccc3c(c2)oc-4c/c(=N/c5ccc(cc5S(=O)(=O)O)OCC)/ccc4c3c6c(ccc(c6C(=O)[O-])Cl)Cl.[Na+] |
| InChi: | InChI=1S/C36H28Cl2N2O8S.Na/c1-3-46-23-9-5-20(6-10-23)39-21-7-12-25-30(17-21)48-31-18-22(40-29-16-11-24(47-4-2)19-32(29)49(43,44)45)8-13-26(31)33(25)34-27(37)14-15-28(38)35(34)36(41)42;/h5-19,39H,3-4H2,1-2H3,(H,41,42)(H,43,44,45);/q;+1/p-1/b40-22+; |
| InChiKey: | InChIKey=SNKAETNQJVDAOJ-QIRCSCBGSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.