* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-OXOHEPTANOIC ACID |
CAS: | 35923-65-0 |
English Synonyms: | 7-OXOHEPTANOIC ACID |
MDL Number.: | MFCD00047662 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C(CCC=O)CCC(=O)O |
InChi: | InChI=1S/C7H12O3/c8-6-4-2-1-3-5-7(9)10/h6H,1-5H2,(H,9,10) |
InChiKey: | InChIKey=OOFMTFUTWFAVGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.